C16H16F3N3S — CID 54391573
1-(3-ethylphenyl)-2-[3-(trifluoromethylsulfanyl)phenyl]guanidine (PubChem CID 54391573) has the molecular formula C16H16F3N3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[3-(trifluoromethylsulfanyl)phenyl]guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-[3-(trifluoromethylsulfanyl)phenyl]guanidine |
|---|---|
| PubChem CID | 54391573 |
| Molecular Formula | C16H16F3N3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[3-(trifluoromethylsulfanyl)phenyl]guanidine |
| SMILES | CCc1cccc(N/C(N)=N/c2cccc(SC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H16F3N3S/c1-2-11-5-3-6-12(9-11)21-15(20)22-13-7-4-8-14(10-13)23-16(17,18)19/h3-10H,2H2,1H3,(H3,20,21,22) |
| InChIKey | VGZXRPMXQPVQPH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|