C19H25Cl2N3 — CID 45262109
2-(2-chloro-3,5-diethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride (PubChem CID 45262109) has the molecular formula C19H25Cl2N3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-(2-chloro-3,5-diethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride.
| Compound Name | 2-(2-chloro-3,5-diethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 45262109 |
| Molecular Formula | C19H25Cl2N3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(2-chloro-3,5-diethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
| SMILES | CCc1cccc(N/C(N)=N/c2cc(CC)cc(CC)c2Cl)c1.Cl |
| InChI | InChI=1S/C19H24ClN3.ClH/c1-4-13-8-7-9-16(11-13)22-19(21)23-17-12-14(5-2)10-15(6-3)18(17)20;/h7-12H,4-6H2,1-3H3,(H3,21,22,23);1H |
| InChIKey | RQJMAWZPBTZWJU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|