C19H19ClFN3 — CID 22121814
1-(5-ethyl-2-fluorophenyl)-2-naphthalen-1-ylguanidine;hydrochloride (PubChem CID 22121814) has the molecular formula C19H19ClFN3 and a molecular weight of 343.83 g/mol. Its IUPAC name is 1-(5-ethyl-2-fluorophenyl)-2-naphthalen-1-ylguanidine;hydrochloride.
| Compound Name | 1-(5-ethyl-2-fluorophenyl)-2-naphthalen-1-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 22121814 |
| Molecular Formula | C19H19ClFN3 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(5-ethyl-2-fluorophenyl)-2-naphthalen-1-ylguanidine;hydrochloride |
| SMILES | CCc1ccc(F)c(N/C(N)=N/c2cccc3ccccc23)c1.Cl |
| InChI | InChI=1S/C19H18FN3.ClH/c1-2-13-10-11-16(20)18(12-13)23-19(21)22-17-9-5-7-14-6-3-4-8-15(14)17;/h3-12H,2H2,1H3,(H3,21,22,23);1H |
| InChIKey | PQGBSGOYUJVQEK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|