C19H16F3N3S — CID 22120056
1-[2-methylsulfanyl-5-(trifluoromethyl)phenyl]-2-naphthalen-1-ylguanidine (PubChem CID 22120056) has the molecular formula C19H16F3N3S and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-[2-methylsulfanyl-5-(trifluoromethyl)phenyl]-2-naphthalen-1-ylguanidine.
| Compound Name | 1-[2-methylsulfanyl-5-(trifluoromethyl)phenyl]-2-naphthalen-1-ylguanidine |
|---|---|
| PubChem CID | 22120056 |
| Molecular Formula | C19H16F3N3S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-[2-methylsulfanyl-5-(trifluoromethyl)phenyl]-2-naphthalen-1-ylguanidine |
| SMILES | CSc1ccc(C(F)(F)F)cc1N/C(N)=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C19H16F3N3S/c1-26-17-10-9-13(19(20,21)22)11-16(17)25-18(23)24-15-8-4-6-12-5-2-3-7-14(12)15/h2-11H,1H3,(H3,23,24,25) |
| InChIKey | TWKIVJTYWDDTQC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|