C16H15BrF3N3S — CID 54570464
2-[2-(2-bromoethylsulfanyl)phenyl]-1-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 54570464) has the molecular formula C16H15BrF3N3S and a molecular weight of 418.28 g/mol. Its IUPAC name is 2-[2-(2-bromoethylsulfanyl)phenyl]-1-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[2-(2-bromoethylsulfanyl)phenyl]-1-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 54570464 |
| Molecular Formula | C16H15BrF3N3S |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2-[2-(2-bromoethylsulfanyl)phenyl]-1-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | N/C(=N\c1ccccc1SCCBr)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15BrF3N3S/c17-8-9-24-14-7-2-1-6-13(14)23-15(21)22-12-5-3-4-11(10-12)16(18,19)20/h1-7,10H,8-9H2,(H3,21,22,23) |
| InChIKey | ZWWLOYJDLLBVFL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|