C13H8ClF6N3S — CID 174364241
2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 174364241) has the molecular formula C13H8ClF6N3S and a molecular weight of 387.74 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 174364241 |
| Molecular Formula | C13H8ClF6N3S |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | N/C(=N\c1cc(C(F)(F)F)sc1Cl)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8ClF6N3S/c14-10-8(5-9(24-10)13(18,19)20)23-11(21)22-7-3-1-2-6(4-7)12(15,16)17/h1-5H,(H3,21,22,23) |
| InChIKey | AGHRXXZCEPPHPS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|