C13H11ClF3N3S2 — CID 174349130
2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-(3-methylsulfanylphenyl)guanidine (PubChem CID 174349130) has the molecular formula C13H11ClF3N3S2 and a molecular weight of 365.83 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-(3-methylsulfanylphenyl)guanidine.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-(3-methylsulfanylphenyl)guanidine |
|---|---|
| PubChem CID | 174349130 |
| Molecular Formula | C13H11ClF3N3S2 |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)thiophen-3-yl]-1-(3-methylsulfanylphenyl)guanidine |
| SMILES | CSc1cccc(N/C(N)=N/c2cc(C(F)(F)F)sc2Cl)c1 |
| InChI | InChI=1S/C13H11ClF3N3S2/c1-21-8-4-2-3-7(5-8)19-12(18)20-9-6-10(13(15,16)17)22-11(9)14/h2-6H,1H3,(H3,18,19,20) |
| InChIKey | LGKVYELMRQXWJA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|