C15H13BrF3N3S — CID 18752103
2-(2-bromo-5-methylsulfanylphenyl)-1-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 18752103) has the molecular formula C15H13BrF3N3S and a molecular weight of 404.26 g/mol. Its IUPAC name is 2-(2-bromo-5-methylsulfanylphenyl)-1-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-(2-bromo-5-methylsulfanylphenyl)-1-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 18752103 |
| Molecular Formula | C15H13BrF3N3S |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-(2-bromo-5-methylsulfanylphenyl)-1-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | CSc1ccc(Br)c(/N=C(\N)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H13BrF3N3S/c1-23-11-5-6-12(16)13(8-11)22-14(20)21-10-4-2-3-9(7-10)15(17,18)19/h2-8H,1H3,(H3,20,21,22) |
| InChIKey | KDVSEWNDMCATFU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|