C16H18BrN3S2 — CID 54051754
2-[2-(2-bromoethylsulfanyl)phenyl]-1-(3-methylsulfanylphenyl)guanidine (PubChem CID 54051754) has the molecular formula C16H18BrN3S2 and a molecular weight of 396.38 g/mol. Its IUPAC name is 2-[2-(2-bromoethylsulfanyl)phenyl]-1-(3-methylsulfanylphenyl)guanidine.
| Compound Name | 2-[2-(2-bromoethylsulfanyl)phenyl]-1-(3-methylsulfanylphenyl)guanidine |
|---|---|
| PubChem CID | 54051754 |
| Molecular Formula | C16H18BrN3S2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 2-[2-(2-bromoethylsulfanyl)phenyl]-1-(3-methylsulfanylphenyl)guanidine |
| SMILES | CSc1cccc(N/C(N)=N/c2ccccc2SCCBr)c1 |
| InChI | InChI=1S/C16H18BrN3S2/c1-21-13-6-4-5-12(11-13)19-16(18)20-14-7-2-3-8-15(14)22-10-9-17/h2-8,11H,9-10H2,1H3,(H3,18,19,20) |
| InChIKey | LTJGLSQXUSXCDP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|