C20H16F3N3 — CID 18752118
2-(1,2-dihydroacenaphthylen-5-yl)-1-[4-(trifluoromethyl)phenyl]guanidine (PubChem CID 18752118) has the molecular formula C20H16F3N3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-(1,2-dihydroacenaphthylen-5-yl)-1-[4-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-(1,2-dihydroacenaphthylen-5-yl)-1-[4-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 18752118 |
| Molecular Formula | C20H16F3N3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-(1,2-dihydroacenaphthylen-5-yl)-1-[4-(trifluoromethyl)phenyl]guanidine |
| SMILES | N/C(=N\c1ccc2c3c(cccc13)CC2)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3N3/c21-20(22,23)14-7-9-15(10-8-14)25-19(24)26-17-11-6-13-5-4-12-2-1-3-16(17)18(12)13/h1-3,6-11H,4-5H2,(H3,24,25,26) |
| InChIKey | YBUVQRRRYZDILB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|