C14H13ClN2 — CID 169369135
2-chloro-N'-(1,2-dihydroacenaphthylen-5-yl)ethanimidamide (PubChem CID 169369135) has the molecular formula C14H13ClN2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-chloro-N'-(1,2-dihydroacenaphthylen-5-yl)ethanimidamide.
| Compound Name | 2-chloro-N'-(1,2-dihydroacenaphthylen-5-yl)ethanimidamide |
|---|---|
| PubChem CID | 169369135 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-chloro-N'-(1,2-dihydroacenaphthylen-5-yl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C14H13ClN2/c15-8-13(16)17-12-7-6-10-5-4-9-2-1-3-11(12)14(9)10/h1-3,6-7H,4-5,8H2,(H2,16,17) |
| InChIKey | FJKQZADVWKEEID-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|