C23H24ClN3 — CID 22675796
1-[1-(4-chlorophenyl)propan-2-yl]-2-(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine (PubChem CID 22675796) has the molecular formula C23H24ClN3 and a molecular weight of 377.92 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)propan-2-yl]-2-(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine.
| Compound Name | 1-[1-(4-chlorophenyl)propan-2-yl]-2-(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 22675796 |
| Molecular Formula | C23H24ClN3 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[1-(4-chlorophenyl)propan-2-yl]-2-(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine |
| SMILES | CC(Cc1ccc(Cl)cc1)N(C)/C(N)=N/c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C23H24ClN3/c1-15(14-16-6-11-19(24)12-7-16)27(2)23(25)26-21-13-10-18-9-8-17-4-3-5-20(21)22(17)18/h3-7,10-13,15H,8-9,14H2,1-2H3,(H2,25,26) |
| InChIKey | SPGLSMZYRVIMAC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|