C20H19N — CID 114939245
1-(1,2-dihydroacenaphthylen-5-yl)-2-phenylethanamine (PubChem CID 114939245) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-2-phenylethanamine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2-phenylethanamine |
|---|---|
| PubChem CID | 114939245 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2-phenylethanamine |
| SMILES | NC(Cc1ccccc1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C20H19N/c21-19(13-14-5-2-1-3-6-14)17-12-11-16-10-9-15-7-4-8-18(17)20(15)16/h1-8,11-12,19H,9-10,13,21H2 |
| InChIKey | FRUBUILSJBLCDO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |