C15H12BrF3 — CID 114939778
5-(1-bromo-3,3,3-trifluoropropyl)-1,2-dihydroacenaphthylene (PubChem CID 114939778) has the molecular formula C15H12BrF3 and a molecular weight of 329.16 g/mol. Its IUPAC name is 5-(1-bromo-3,3,3-trifluoropropyl)-1,2-dihydroacenaphthylene.
| Compound Name | 5-(1-bromo-3,3,3-trifluoropropyl)-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 114939778 |
| Molecular Formula | C15H12BrF3 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5-(1-bromo-3,3,3-trifluoropropyl)-1,2-dihydroacenaphthylene |
| SMILES | FC(F)(F)CC(Br)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C15H12BrF3/c16-13(8-15(17,18)19)11-7-6-10-5-4-9-2-1-3-12(11)14(9)10/h1-3,6-7,13H,4-5,8H2 |
| InChIKey | UXUOVHRIGICEAY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|