C16H17BrO2S — CID 114939698
5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene (PubChem CID 114939698) has the molecular formula C16H17BrO2S and a molecular weight of 353.28 g/mol. Its IUPAC name is 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene.
| Compound Name | 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 114939698 |
| Molecular Formula | C16H17BrO2S |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene |
| SMILES | CC(C(Br)c1ccc2c3c(cccc13)CC2)S(C)(=O)=O |
| InChI | InChI=1S/C16H17BrO2S/c1-10(20(2,18)19)16(17)14-9-8-12-7-6-11-4-3-5-13(14)15(11)12/h3-5,8-10,16H,6-7H2,1-2H3 |
| InChIKey | PQIXRGCJMZEAOA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|