About 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene
5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene (PubChem CID 114939698) has the molecular formula C16H17BrO2S
and a molecular weight of 353.28 g/mol. Its IUPAC name is 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene |
| PubChem CID | 114939698 |
| Molecular Formula | C16H17BrO2S |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene |
| SMILES | CC(C(Br)c1ccc2c3c(cccc13)CC2)S(C)(=O)=O |
| InChI | InChI=1S/C16H17BrO2S/c1-10(20(2,18)19)16(17)14-9-8-12-7-6-11-4-3-5-13(14)15(11)12/h3-5,8-10,16H,6-7H2,1-2H3 |
| InChIKey | PQIXRGCJMZEAOA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene?
The IUPAC name of 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene (CID 114939698) is 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene.
What is the SMILES notation for 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene?
The canonical SMILES for 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene is CC(C(Br)c1ccc2c3c(cccc13)CC2)S(C)(=O)=O.
What is the InChIKey of 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene?
The InChIKey is PQIXRGCJMZEAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrO2S/c1-10(20(2,18)19)16(17)14-9-8-12-7-6-11-4-3-5-13(14)15(11)12/h3-5,8-10,16H,6-7H2,1-2H3.
What are the key properties of 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene?
5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene has a molecular weight of 353.28 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-bromo-2-methylsulfonylpropyl)-1,2-dihydroacenaphthylene is sourced from PubChem (CID 114939698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).