C15H11F5O — CID 114939506
1-(1,2-dihydroacenaphthylen-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 114939506) has the molecular formula C15H11F5O and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 114939506 |
| Molecular Formula | C15H11F5O |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | OC(c1ccc2c3c(cccc13)CC2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H11F5O/c16-14(17,15(18,19)20)13(21)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7,13,21H,4-5H2 |
| InChIKey | BLNDIYUOARMANT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|