C13H8ClF5O — CID 79597809
1-(4-chloronaphthalen-1-yl)-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 79597809) has the molecular formula C13H8ClF5O and a molecular weight of 310.65 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 79597809 |
| Molecular Formula | C13H8ClF5O |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | OC(c1ccc(Cl)c2ccccc12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF5O/c14-10-6-5-9(7-3-1-2-4-8(7)10)11(20)12(15,16)13(17,18)19/h1-6,11,20H |
| InChIKey | RMRBUCGLNFJZIA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|