C12H8ClF3O — CID 79597742
1-(4-chloronaphthalen-1-yl)-2,2,2-trifluoroethanol (PubChem CID 79597742) has the molecular formula C12H8ClF3O and a molecular weight of 260.64 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 79597742 |
| Molecular Formula | C12H8ClF3O |
| Molecular Weight | 260.64 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc(Cl)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C12H8ClF3O/c13-10-6-5-9(11(17)12(14,15)16)7-3-1-2-4-8(7)10/h1-6,11,17H |
| InChIKey | MOFNTMYBZJEPBN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |