C15H18ClN — CID 79597241
1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-amine (PubChem CID 79597241) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-amine.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 79597241 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H18ClN/c1-15(2,3)14(17)12-8-9-13(16)11-7-5-4-6-10(11)12/h4-9,14H,17H2,1-3H3 |
| InChIKey | XNLASXQZOVWOGJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |