C17H22ClN — CID 79597722
1-(4-chloronaphthalen-1-yl)-N,3,3-trimethylbutan-1-amine (PubChem CID 79597722) has the molecular formula C17H22ClN and a molecular weight of 275.82 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-N,3,3-trimethylbutan-1-amine.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-N,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 79597722 |
| Molecular Formula | C17H22ClN |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-N,3,3-trimethylbutan-1-amine |
| SMILES | CNC(CC(C)(C)C)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H22ClN/c1-17(2,3)11-16(19-4)14-9-10-15(18)13-8-6-5-7-12(13)14/h5-10,16,19H,11H2,1-4H3 |
| InChIKey | MRINJIIZTXPJMH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |