C18H24ClN — CID 79596816
1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylbutan-1-amine (PubChem CID 79596816) has the molecular formula C18H24ClN and a molecular weight of 289.85 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylbutan-1-amine.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79596816 |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CC(C)C)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C18H24ClN/c1-4-11-20-18(12-13(2)3)16-9-10-17(19)15-8-6-5-7-14(15)16/h5-10,13,18,20H,4,11-12H2,1-3H3 |
| InChIKey | SKGKKASQGJYUTD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |