C19H26ClN — CID 114874516
1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylpentan-1-amine (PubChem CID 114874516) has the molecular formula C19H26ClN and a molecular weight of 303.88 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylpentan-1-amine.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 114874516 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-3-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CC(C)CC)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C19H26ClN/c1-4-12-21-19(13-14(3)5-2)17-10-11-18(20)16-9-7-6-8-15(16)17/h6-11,14,19,21H,4-5,12-13H2,1-3H3 |
| InChIKey | FOMUZWAMGPSNST-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |