C20H29N — CID 114874570
3-methyl-1-(2-methylnaphthalen-1-yl)-N-propylpentan-1-amine (PubChem CID 114874570) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 3-methyl-1-(2-methylnaphthalen-1-yl)-N-propylpentan-1-amine.
| Compound Name | 3-methyl-1-(2-methylnaphthalen-1-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 114874570 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 3-methyl-1-(2-methylnaphthalen-1-yl)-N-propylpentan-1-amine |
| SMILES | CCCNC(CC(C)CC)c1c(C)ccc2ccccc12 |
| InChI | InChI=1S/C20H29N/c1-5-13-21-19(14-15(3)6-2)20-16(4)11-12-17-9-7-8-10-18(17)20/h7-12,15,19,21H,5-6,13-14H2,1-4H3 |
| InChIKey | WXRJCTKGVBGRCN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |