C16H26BrN — CID 115846083
1-(5-bromo-2-methylphenyl)-3-methyl-N-propylpentan-1-amine (PubChem CID 115846083) has the molecular formula C16H26BrN and a molecular weight of 312.30 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-3-methyl-N-propylpentan-1-amine.
| Compound Name | 1-(5-bromo-2-methylphenyl)-3-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 115846083 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-3-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CC(C)CC)c1cc(Br)ccc1C |
| InChI | InChI=1S/C16H26BrN/c1-5-9-18-16(10-12(3)6-2)15-11-14(17)8-7-13(15)4/h7-8,11-12,16,18H,5-6,9-10H2,1-4H3 |
| InChIKey | BCXQRSLCHSNVLD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |