C14H25NS — CID 102841960
3-methyl-1-(2-methylthiophen-3-yl)-N-propylpentan-1-amine (PubChem CID 102841960) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 3-methyl-1-(2-methylthiophen-3-yl)-N-propylpentan-1-amine.
| Compound Name | 3-methyl-1-(2-methylthiophen-3-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 102841960 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-methyl-1-(2-methylthiophen-3-yl)-N-propylpentan-1-amine |
| SMILES | CCCNC(CC(C)CC)c1ccsc1C |
| InChI | InChI=1S/C14H25NS/c1-5-8-15-14(10-11(3)6-2)13-7-9-16-12(13)4/h7,9,11,14-15H,5-6,8,10H2,1-4H3 |
| InChIKey | SQCFYOCOHKOJDX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |