C16H25NS — CID 102833821
N-[2-(cyclohexen-1-yl)-1-(2-methylthiophen-3-yl)ethyl]propan-1-amine (PubChem CID 102833821) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-1-(2-methylthiophen-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)-1-(2-methylthiophen-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102833821 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-1-(2-methylthiophen-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1=CCCCC1)c1ccsc1C |
| InChI | InChI=1S/C16H25NS/c1-3-10-17-16(15-9-11-18-13(15)2)12-14-7-5-4-6-8-14/h7,9,11,16-17H,3-6,8,10,12H2,1-2H3 |
| InChIKey | DICNKSSQLARGDA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|