C17H23Cl2N — CID 116662088
N-[2-(cyclohexen-1-yl)-1-(2,3-dichlorophenyl)ethyl]propan-1-amine (PubChem CID 116662088) has the molecular formula C17H23Cl2N and a molecular weight of 312.28 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-1-(2,3-dichlorophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)-1-(2,3-dichlorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 116662088 |
| Molecular Formula | C17H23Cl2N |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-1-(2,3-dichlorophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1=CCCCC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H23Cl2N/c1-2-11-20-16(12-13-7-4-3-5-8-13)14-9-6-10-15(18)17(14)19/h6-7,9-10,16,20H,2-5,8,11-12H2,1H3 |
| InChIKey | QMCCECYHROAGPO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|