C11H15Cl2NO — CID 61054379
2-(2,3-dichlorophenyl)-2-(propylamino)ethanol (PubChem CID 61054379) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-2-(propylamino)ethanol.
| Compound Name | 2-(2,3-dichlorophenyl)-2-(propylamino)ethanol |
|---|---|
| PubChem CID | 61054379 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-2-(propylamino)ethanol |
| SMILES | CCCNC(CO)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H15Cl2NO/c1-2-6-14-10(7-15)8-4-3-5-9(12)11(8)13/h3-5,10,14-15H,2,6-7H2,1H3 |
| InChIKey | AJKJMYKPVYGSNN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |