C12H19NO — CID 61056185
2-(2-methylphenyl)-2-(propylamino)ethanol (PubChem CID 61056185) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2-(propylamino)ethanol.
| Compound Name | 2-(2-methylphenyl)-2-(propylamino)ethanol |
|---|---|
| PubChem CID | 61056185 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(2-methylphenyl)-2-(propylamino)ethanol |
| SMILES | CCCNC(CO)c1ccccc1C |
| InChI | InChI=1S/C12H19NO/c1-3-8-13-12(9-14)11-7-5-4-6-10(11)2/h4-7,12-14H,3,8-9H2,1-2H3 |
| InChIKey | FGQGJZNMAGCPOT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |