C17H20Cl2N2 — CID 105141906
1-(2,3-dichlorophenyl)-N-propyl-3-pyridin-3-ylpropan-1-amine (PubChem CID 105141906) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-propyl-3-pyridin-3-ylpropan-1-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-propyl-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 105141906 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-propyl-3-pyridin-3-ylpropan-1-amine |
| SMILES | CCCNC(CCc1cccnc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H20Cl2N2/c1-2-10-21-16(9-8-13-5-4-11-20-12-13)14-6-3-7-15(18)17(14)19/h3-7,11-12,16,21H,2,8-10H2,1H3 |
| InChIKey | GJOBIAUZRSKNGG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |