C15H17ClN2 — CID 105099694
1-(2-chlorophenyl)-N-methyl-3-pyridin-3-ylpropan-1-amine (PubChem CID 105099694) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-methyl-3-pyridin-3-ylpropan-1-amine.
| Compound Name | 1-(2-chlorophenyl)-N-methyl-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 105099694 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-(2-chlorophenyl)-N-methyl-3-pyridin-3-ylpropan-1-amine |
| SMILES | CNC(CCc1cccnc1)c1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN2/c1-17-15(13-6-2-3-7-14(13)16)9-8-12-5-4-10-18-11-12/h2-7,10-11,15,17H,8-9H2,1H3 |
| InChIKey | WJCALWCXTCBNJD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |