C19H24ClN — CID 107102031
1-(3-chloro-2-methylphenyl)-3-phenyl-N-propylpropan-1-amine (PubChem CID 107102031) has the molecular formula C19H24ClN and a molecular weight of 301.86 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-phenyl-N-propylpropan-1-amine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-phenyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 107102031 |
| Molecular Formula | C19H24ClN |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-phenyl-N-propylpropan-1-amine |
| SMILES | CCCNC(CCc1ccccc1)c1cccc(Cl)c1C |
| InChI | InChI=1S/C19H24ClN/c1-3-14-21-19(13-12-16-8-5-4-6-9-16)17-10-7-11-18(20)15(17)2/h4-11,19,21H,3,12-14H2,1-2H3 |
| InChIKey | PXYJVBLGLOYESS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |