C13H20ClN — CID 107101962
1-(3-chloro-2-methylphenyl)-N-ethylbutan-1-amine (PubChem CID 107101962) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-N-ethylbutan-1-amine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-N-ethylbutan-1-amine |
|---|---|
| PubChem CID | 107101962 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-N-ethylbutan-1-amine |
| SMILES | CCCC(NCC)c1cccc(Cl)c1C |
| InChI | InChI=1S/C13H20ClN/c1-4-7-13(15-5-2)11-8-6-9-12(14)10(11)3/h6,8-9,13,15H,4-5,7H2,1-3H3 |
| InChIKey | BBSXKZBEGYCWCQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |