C18H30ClN — CID 107102078
1-(3-chloro-2-methylphenyl)-N,3-diethylheptan-1-amine (PubChem CID 107102078) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-N,3-diethylheptan-1-amine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-N,3-diethylheptan-1-amine |
|---|---|
| PubChem CID | 107102078 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-N,3-diethylheptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)c1cccc(Cl)c1C |
| InChI | InChI=1S/C18H30ClN/c1-5-8-10-15(6-2)13-18(20-7-3)16-11-9-12-17(19)14(16)4/h9,11-12,15,18,20H,5-8,10,13H2,1-4H3 |
| InChIKey | RVTQENWLJXFIKH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |