C17H28IN — CID 115805946
N,3-diethyl-1-(4-iodophenyl)heptan-1-amine (PubChem CID 115805946) has the molecular formula C17H28IN and a molecular weight of 373.32 g/mol. Its IUPAC name is N,3-diethyl-1-(4-iodophenyl)heptan-1-amine.
| Compound Name | N,3-diethyl-1-(4-iodophenyl)heptan-1-amine |
|---|---|
| PubChem CID | 115805946 |
| Molecular Formula | C17H28IN |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N,3-diethyl-1-(4-iodophenyl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H28IN/c1-4-7-8-14(5-2)13-17(19-6-3)15-9-11-16(18)12-10-15/h9-12,14,17,19H,4-8,13H2,1-3H3 |
| InChIKey | VORCEHSAQNUHEF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|