C17H31NO — CID 115806207
N,3-diethyl-1-(5-ethylfuran-2-yl)heptan-1-amine (PubChem CID 115806207) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N,3-diethyl-1-(5-ethylfuran-2-yl)heptan-1-amine.
| Compound Name | N,3-diethyl-1-(5-ethylfuran-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 115806207 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N,3-diethyl-1-(5-ethylfuran-2-yl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)c1ccc(CC)o1 |
| InChI | InChI=1S/C17H31NO/c1-5-9-10-14(6-2)13-16(18-8-4)17-12-11-15(7-3)19-17/h11-12,14,16,18H,5-10,13H2,1-4H3 |
| InChIKey | MAIHTBFUXXWXSD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |