C16H29NO — CID 63416317
3-ethyl-1-(furan-2-yl)-N-propylheptan-1-amine (PubChem CID 63416317) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 3-ethyl-1-(furan-2-yl)-N-propylheptan-1-amine.
| Compound Name | 3-ethyl-1-(furan-2-yl)-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 63416317 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 3-ethyl-1-(furan-2-yl)-N-propylheptan-1-amine |
| SMILES | CCCCC(CC)CC(NCCC)c1ccco1 |
| InChI | InChI=1S/C16H29NO/c1-4-7-9-14(6-3)13-15(17-11-5-2)16-10-8-12-18-16/h8,10,12,14-15,17H,4-7,9,11,13H2,1-3H3 |
| InChIKey | SSAIFFJCLNVIPM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |