C15H27NO — CID 63833258
1-(furan-2-yl)-3,4,4-trimethyl-N-propylpentan-1-amine (PubChem CID 63833258) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(furan-2-yl)-3,4,4-trimethyl-N-propylpentan-1-amine.
| Compound Name | 1-(furan-2-yl)-3,4,4-trimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 63833258 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-(furan-2-yl)-3,4,4-trimethyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CC(C)C(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C15H27NO/c1-6-9-16-13(14-8-7-10-17-14)11-12(2)15(3,4)5/h7-8,10,12-13,16H,6,9,11H2,1-5H3 |
| InChIKey | GRECIRVSNGDOEP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |