C15H27NO — CID 82984685
1-(furan-2-yl)-N,2-dipropylpentan-1-amine (PubChem CID 82984685) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(furan-2-yl)-N,2-dipropylpentan-1-amine.
| Compound Name | 1-(furan-2-yl)-N,2-dipropylpentan-1-amine |
|---|---|
| PubChem CID | 82984685 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-(furan-2-yl)-N,2-dipropylpentan-1-amine |
| SMILES | CCCNC(c1ccco1)C(CCC)CCC |
| InChI | InChI=1S/C15H27NO/c1-4-8-13(9-5-2)15(16-11-6-3)14-10-7-12-17-14/h7,10,12-13,15-16H,4-6,8-9,11H2,1-3H3 |
| InChIKey | BCOUTDWNWXPXBK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |