C10H17NO2 — CID 79412972
2-(aminomethyl)-1-(furan-2-yl)pentan-1-ol (PubChem CID 79412972) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(furan-2-yl)pentan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(furan-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 79412972 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-(aminomethyl)-1-(furan-2-yl)pentan-1-ol |
| SMILES | CCCC(CN)C(O)c1ccco1 |
| InChI | InChI=1S/C10H17NO2/c1-2-4-8(7-11)10(12)9-5-3-6-13-9/h3,5-6,8,10,12H,2,4,7,11H2,1H3 |
| InChIKey | CVXLPPSBELCKAI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |