About acetylene;(1S)-1-(furan-2-yl)propan-1-ol
acetylene;(1S)-1-(furan-2-yl)propan-1-ol (PubChem CID 143788269) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is acetylene;(1S)-1-(furan-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | acetylene;(1S)-1-(furan-2-yl)propan-1-ol |
| PubChem CID | 143788269 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | acetylene;(1S)-1-(furan-2-yl)propan-1-ol |
| SMILES | C#C.CC[C@H](O)c1ccco1 |
| InChI | InChI=1S/C7H10O2.C2H2/c1-2-6(8)7-4-3-5-9-7;1-2/h3-6,8H,2H2,1H3;1-2H/t6-;/m0./s1 |
| InChIKey | NJSRFCJCLYSXTM-RGMNGODLSA-N |
| XLogP | 1.97 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(1S)-1-(furan-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(1S)-1-(furan-2-yl)propan-1-ol?
The IUPAC name of acetylene;(1S)-1-(furan-2-yl)propan-1-ol (CID 143788269) is acetylene;(1S)-1-(furan-2-yl)propan-1-ol.
What is the SMILES notation for acetylene;(1S)-1-(furan-2-yl)propan-1-ol?
The canonical SMILES for acetylene;(1S)-1-(furan-2-yl)propan-1-ol is C#C.CC[C@H](O)c1ccco1.
What is the InChIKey of acetylene;(1S)-1-(furan-2-yl)propan-1-ol?
The InChIKey is NJSRFCJCLYSXTM-RGMNGODLSA-N. The full InChI is InChI=1S/C7H10O2.C2H2/c1-2-6(8)7-4-3-5-9-7;1-2/h3-6,8H,2H2,1H3;1-2H/t6-;/m0./s1.
What are the key properties of acetylene;(1S)-1-(furan-2-yl)propan-1-ol?
acetylene;(1S)-1-(furan-2-yl)propan-1-ol has a molecular weight of 152.19 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(1S)-1-(furan-2-yl)propan-1-ol is sourced from PubChem (CID 143788269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).