C8H12O3 — CID 46177371
(1S,3S)-1-(furan-2-yl)butane-1,3-diol (PubChem CID 46177371) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (1S,3S)-1-(furan-2-yl)butane-1,3-diol.
| Compound Name | (1S,3S)-1-(furan-2-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 46177371 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (1S,3S)-1-(furan-2-yl)butane-1,3-diol |
| SMILES | C[C@H](O)C[C@H](O)c1ccco1 |
| InChI | InChI=1S/C8H12O3/c1-6(9)5-7(10)8-3-2-4-11-8/h2-4,6-7,9-10H,5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | ICRWDOSEGCMWPS-BQBZGAKWSA-N |
| XLogP | 1.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |