About furan;1-(furan-2-yl)-3-methylbutan-1-ol
furan;1-(furan-2-yl)-3-methylbutan-1-ol (PubChem CID 23208167) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is furan;1-(furan-2-yl)-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | furan;1-(furan-2-yl)-3-methylbutan-1-ol |
| PubChem CID | 23208167 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | furan;1-(furan-2-yl)-3-methylbutan-1-ol |
| SMILES | CC(C)CC(O)c1ccco1.c1ccoc1 |
| InChI | InChI=1S/C9H14O2.C4H4O/c1-7(2)6-8(10)9-4-3-5-11-9;1-2-4-5-3-1/h3-5,7-8,10H,6H2,1-2H3;1-4H |
| InChIKey | WEBBKJSGEYNTDE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan;1-(furan-2-yl)-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan;1-(furan-2-yl)-3-methylbutan-1-ol?
The IUPAC name of furan;1-(furan-2-yl)-3-methylbutan-1-ol (CID 23208167) is furan;1-(furan-2-yl)-3-methylbutan-1-ol.
What is the SMILES notation for furan;1-(furan-2-yl)-3-methylbutan-1-ol?
The canonical SMILES for furan;1-(furan-2-yl)-3-methylbutan-1-ol is CC(C)CC(O)c1ccco1.c1ccoc1.
What is the InChIKey of furan;1-(furan-2-yl)-3-methylbutan-1-ol?
The InChIKey is WEBBKJSGEYNTDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C4H4O/c1-7(2)6-8(10)9-4-3-5-11-9;1-2-4-5-3-1/h3-5,7-8,10H,6H2,1-2H3;1-4H.
What are the key properties of furan;1-(furan-2-yl)-3-methylbutan-1-ol?
furan;1-(furan-2-yl)-3-methylbutan-1-ol has a molecular weight of 222.28 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan;1-(furan-2-yl)-3-methylbutan-1-ol is sourced from PubChem (CID 23208167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).