C9H14O4 — CID 175602784
1-(furan-2-yl)pentane-1,3,4-triol (PubChem CID 175602784) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(furan-2-yl)pentane-1,3,4-triol.
| Compound Name | 1-(furan-2-yl)pentane-1,3,4-triol |
|---|---|
| PubChem CID | 175602784 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(furan-2-yl)pentane-1,3,4-triol |
| SMILES | CC(O)C(O)CC(O)c1ccco1 |
| InChI | InChI=1S/C9H14O4/c1-6(10)7(11)5-8(12)9-3-2-4-13-9/h2-4,6-8,10-12H,5H2,1H3 |
| InChIKey | RBROUYKMTXYOQC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |