C9H14O3 — CID 72990739
1-(furan-2-yl)-2-methylbutane-1,3-diol (PubChem CID 72990739) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-methylbutane-1,3-diol.
| Compound Name | 1-(furan-2-yl)-2-methylbutane-1,3-diol |
|---|---|
| PubChem CID | 72990739 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-(furan-2-yl)-2-methylbutane-1,3-diol |
| SMILES | CC(O)C(C)C(O)c1ccco1 |
| InChI | InChI=1S/C9H14O3/c1-6(7(2)10)9(11)8-4-3-5-12-8/h3-7,9-11H,1-2H3 |
| InChIKey | QUXDZLYRDVSRPU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |