C7H9NO4 — CID 44604534
(1S,2R)-1-(furan-2-yl)-2-nitropropan-1-ol (PubChem CID 44604534) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is (1S,2R)-1-(furan-2-yl)-2-nitropropan-1-ol.
| Compound Name | (1S,2R)-1-(furan-2-yl)-2-nitropropan-1-ol |
|---|---|
| PubChem CID | 44604534 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (1S,2R)-1-(furan-2-yl)-2-nitropropan-1-ol |
| SMILES | C[C@H]([C@H](O)c1ccco1)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9NO4/c1-5(8(10)11)7(9)6-3-2-4-12-6/h2-5,7,9H,1H3/t5-,7+/m1/s1 |
| InChIKey | VAJZYHHMLZZNTL-VDTYLAMSSA-N |
| XLogP | 0.98 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|