C11H12O5 — CID 70525722
1,3-bis(furan-2-yl)propane-1,2,3-triol (PubChem CID 70525722) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 1,3-bis(furan-2-yl)propane-1,2,3-triol.
| Compound Name | 1,3-bis(furan-2-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 70525722 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1,3-bis(furan-2-yl)propane-1,2,3-triol |
| SMILES | OC(c1ccco1)C(O)C(O)c1ccco1 |
| InChI | InChI=1S/C11H12O5/c12-9(7-3-1-5-15-7)11(14)10(13)8-4-2-6-16-8/h1-6,9-14H |
| InChIKey | UJLHCHSYKZVMKC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |