C13H12O4 — CID 3088964
(2R,3R)-3-(furan-2-yl)-3-hydroxy-2-phenylpropanoic acid (PubChem CID 3088964) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2R,3R)-3-(furan-2-yl)-3-hydroxy-2-phenylpropanoic acid.
| Compound Name | (2R,3R)-3-(furan-2-yl)-3-hydroxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 3088964 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2R,3R)-3-(furan-2-yl)-3-hydroxy-2-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](c1ccccc1)[C@@H](O)c1ccco1 |
| InChI | InChI=1S/C13H12O4/c14-12(10-7-4-8-17-10)11(13(15)16)9-5-2-1-3-6-9/h1-8,11-12,14H,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | ZFLMKKDXXLZURV-NEPJUHHUSA-N |
| XLogP | 2.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |