C11H10F2O4 — CID 10105858
2,2-difluoro-1,3-bis(furan-2-yl)propane-1,3-diol (PubChem CID 10105858) has the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis(furan-2-yl)propane-1,3-diol.
| Compound Name | 2,2-difluoro-1,3-bis(furan-2-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 10105858 |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2,2-difluoro-1,3-bis(furan-2-yl)propane-1,3-diol |
| SMILES | OC(c1ccco1)C(F)(F)C(O)c1ccco1 |
| InChI | InChI=1S/C11H10F2O4/c12-11(13,9(14)7-3-1-5-16-7)10(15)8-4-2-6-17-8/h1-6,9-10,14-15H |
| InChIKey | YFXFOEARPFGZJH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |