C12H9F3O2 — CID 66743675
2,2,2-trifluoro-1-[2-(furan-2-yl)phenyl]ethanol (PubChem CID 66743675) has the molecular formula C12H9F3O2 and a molecular weight of 242.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(furan-2-yl)phenyl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[2-(furan-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 66743675 |
| Molecular Formula | C12H9F3O2 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(furan-2-yl)phenyl]ethanol |
| SMILES | OC(c1ccccc1-c1ccco1)C(F)(F)F |
| InChI | InChI=1S/C12H9F3O2/c13-12(14,15)11(16)9-5-2-1-4-8(9)10-6-3-7-17-10/h1-7,11,16H |
| InChIKey | ANDPNMFOMREMQA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |